CAS 884494-45-5: 2-Fluoro-4-iodo-6-methylpyridine

Description:2-Fluoro-4-iodo-6-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a fluorine atom at the 2-position, an iodine atom at the 4-position, and a methyl group at the 6-position. This compound is part of the pyridine family, which is known for its aromatic properties and basicity due to the nitrogen atom in the ring. The presence of halogen substituents, specifically fluorine and iodine, can significantly influence its reactivity and physical properties, such as solubility and boiling point. The methyl group contributes to the overall hydrophobic character of the molecule. 2-Fluoro-4-iodo-6-methylpyridine may be utilized in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals, due to its unique electronic and steric properties. Additionally, the compound's structure allows for potential applications in medicinal chemistry, where modifications to the pyridine ring can lead to compounds with desired biological activities.

Formula:C₆H₅FIN

InChI:InChI=1S/C6H5FIN/c1-4-2-5(8)3-6(7)9-4/h2-3H,1H3

InChI key:InChIKey=LJTFIDJMXXZXPN-UHFFFAOYSA-N

SMILES:FC=1N=C(C=C(I)C1)C

Synonyms:
2-Fluoro-4-Iodo-6-Methyl-Pyridine
2-Fluoro-4-iodo-6-methylpyridine
Pyridine, 2-Fluoro-4-Iodo-6-Methyl-
2-Fluoro-4-iodo-6-picoline

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-fluoro-4-iodo-6-methylpyridine REF: IN-DA0033B1CAS: 884494-45-5	95%	To inquire	Tue 29 Apr 25
2-Fluoro-4-iodo-6-methylpyridine REF: 10-F220251CAS: 884494-45-5	95.0%	62.00 €~936.00 €	Wed 30 Apr 25
2-Fluoro-4-iodo-6-methylpyridine REF: 54-PC445040CAS: 884494-45-5	95%	152.00 €~511.00 €	Tue 06 May 25
2-Fluoro-4-iodo-6-methyl-pyridine REF: 3D-FF43393CAS: 884494-45-5	Min. 95%	- - -	Discontinued product