CAS 884494-49-9

2-chloro-5-fluoro-4-iodopyridine

Description:

2-Chloro-5-fluoro-4-iodopyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three halogen substituents: a chlorine atom at the 2-position, a fluorine atom at the 5-position, and an iodine atom at the 4-position of the pyridine ring. These halogen substituents can significantly influence the compound's reactivity, polarity, and overall chemical behavior. The presence of multiple halogens often enhances the compound's utility in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure contributes to its potential applications in agrochemicals and materials science. As with many halogenated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts.

Formula: C₅H₂ClFIN

InChI: InChI=1/C5H2ClFIN/c6-5-1-4(8)3(7)2-9-5/h1-2H

SMILES: c1c(c(cnc1Cl)F)I

Synonyms:

• Pyridine, 2-Chloro-5-Fluoro-4-Iodo-

2-Chloro-5-fluoro-4-iodopyridine

CAS: 884494-49-9

Formula: C₅H₂ClFIN

Purity: 98%

Color and Shape: Solid

Molecular weight: 257.4320

Ref: IN-DA003GYH

2-Chloro-5-fluoro-4-iodopyridine

CAS: 884494-49-9

2-Chloro-5-fluoro-4-iodopyridine

Formula: C₅H₂ClFIN

Purity: 98%

Color and Shape: white solid

Molecular weight: 257.43g/mol

Ref: 54-PC445042

2-Chloro-5-fluoro-4-iodopyridine

CAS: 884494-49-9

Purity: 95%

Molecular weight: 257.432

Ref: FT-C13093

2-Chloro-5-fluoro-4-iodopyridine

CAS: 884494-49-9

Formula: C₅H₂ClFIN

Purity: 98%

Color and Shape: White powder

Molecular weight: 257.43

Ref: 10-F069656