CAS 884494-59-1

3-Methyl-6-(trifluoromethyl)-1H-indole

Description:

3-Methyl-6-(trifluoromethyl)-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methyl group at the 3-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing biological activity. As a result, compounds with trifluoromethyl groups often exhibit increased potency in pharmaceutical applications. The indole moiety is also recognized for its role in various biological systems, making this compound of interest in medicinal chemistry and drug development. Additionally, the compound's stability and reactivity can be affected by the presence of the trifluoromethyl group, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, 3-Methyl-6-(trifluoromethyl)-1H-indole is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₈F₃N

InChI: InChI=1S/C10H8F3N/c1-6-5-14-9-4-7(10(11,12)13)2-3-8(6)9/h2-5,14H,1H3

InChI key: InChIKey=ILZTWXURGRBKKI-UHFFFAOYSA-N

SMILES: CC=1C=2C(=CC(C(F)(F)F)=CC2)NC1

Synonyms:

• 3-Methyl-6-(trifluoromethyl)-1H-indole
• 1H-Indole, 3-methyl-6-(trifluoromethyl)-