CymitQuimica logo

CAS 884494-68-2

:

4-Bromo-3-ethoxybenzonitrile

Description:
4-Bromo-3-ethoxybenzonitrile is an organic compound characterized by its aromatic structure, featuring a bromine atom and an ethoxy group attached to a benzene ring, along with a nitrile functional group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The ethoxy group contributes to the compound's solubility in organic solvents and can affect its electronic properties. The nitrile group, characterized by a carbon triple-bonded to a nitrogen atom, imparts significant polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C9H8BrNO
InChI:InChI=1S/C9H8BrNO/c1-2-12-9-5-7(6-11)3-4-8(9)10/h3-5H,2H2,1H3
InChI key:InChIKey=GQIYEMYPXFLQSY-UHFFFAOYSA-N
SMILES:O(CC)C1=CC(C#N)=CC=C1Br
Synonyms:
  • 4-Bromo-3-ethoxybenzonitrile
  • Benzonitrile, 4-bromo-3-ethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.