CAS 884494-70-6

2-chloro-4-methyl-pyridin-3-ol

Description:

2-Chloro-4-methyl-pyridin-3-ol, with the CAS number 884494-70-6, is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a chlorine atom and a hydroxyl group. This compound features a methyl group at the 4-position and a hydroxyl group at the 3-position of the pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The chlorine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of both the chlorine and hydroxyl groups can impart biological activity, making it of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-chloro-4-methyl-pyridin-3-ol is a versatile compound with applications in synthetic chemistry and potential biological significance.

Formula: C₆H₆ClNO

InChI: InChI=1/C6H6ClNO/c1-4-2-3-8-6(7)5(4)9/h2-3,9H,1H3

SMILES: Cc1ccnc(c1O)Cl

Synonyms:

• 2-Chloro-4-methylpyridin-3-ol
• 3-Pyridinol, 2-Chloro-4-Methyl-
• 2-Chloro-3-Hydroxy-4-Picoline

2-Chloro-3-hydroxy-4-picoline

CAS: 884494-70-6

Formula: C₆H₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.5709

Ref: IN-DA008CNI

2-Chloro-3-hydroxy-4-picoline

CAS: 884494-70-6

2-Chloro-3-hydroxy-4-picoline

Purity: 97%

Molecular weight: 143.57g/mol

Ref: 54-OR912990

2-Chloro-4-methylpyridin-3-ol

CAS: 884494-70-6

Formula: C₆H₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.57

Ref: 10-F208934