CAS 884494-72-8

5-Carboxy-2-nitrobenzeneacetic acid

Description:

5-Carboxy-2-nitrobenzeneacetic acid, with the CAS number 884494-72-8, is an organic compound characterized by its aromatic structure and functional groups. It features a nitro group (-NO2) and a carboxylic acid group (-COOH) attached to a benzene ring, which contributes to its acidity and potential reactivity. The presence of the nitro group typically enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. This compound is likely to be soluble in polar solvents due to the carboxylic acid group, while its aromatic nature may impart some hydrophobic characteristics. It may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. The compound's synthesis and applications could involve its use as an intermediate in organic synthesis or as a building block for more complex molecules. Safety data and handling precautions should be considered, as compounds with nitro groups can sometimes be hazardous.

Formula: C₉H₇NO₆

InChI: InChI=1S/C9H7NO6/c11-8(12)4-6-3-5(9(13)14)1-2-7(6)10(15)16/h1-3H,4H2,(H,11,12)(H,13,14)

InChI key: InChIKey=AZEOSFLCWVMKLE-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(N(=O)=O)C=CC(C(O)=O)=C1

Synonyms:

• 5-Carboxy-2-nitrobenzeneacetic acid
• Benzeneacetic acid, 5-carboxy-2-nitro-