CAS 884494-76-2
:2-pyridinecarboxylic acid, 6-chloro-3-fluoro-
Description:
2-Pyridinecarboxylic acid, 6-chloro-3-fluoro- is an aromatic heterocyclic compound characterized by a pyridine ring substituted with a carboxylic acid group, a chlorine atom at the 6-position, and a fluorine atom at the 3-position. This compound typically exhibits properties associated with both pyridine derivatives and carboxylic acids, such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The chlorine and fluorine substituents can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical species. The presence of these halogens may also contribute to its stability and lipophilicity. As a result, 2-pyridinecarboxylic acid, 6-chloro-3-fluoro- may find applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods or detailed literature studies.
Formula:C6H3ClFNO2
InChI:InChI=1/C6H3ClFNO2/c7-4-2-1-3(8)5(9-4)6(10)11/h1-2H,(H,10,11)
SMILES:c1cc(Cl)nc(c1F)C(=O)O
Synonyms:- 6-Chloro-3-Fluoropyridine-2-Carboxylic Acid
- 6-Chloro-3-fluoropicolinic acid
- 2-Chloro-5-fluoropyridine-6-carboxylic acid
- 6-Chloro-3-fluoro-2-picolinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Chloro-3-fluoropicolinic acid
CAS:Formula:C6H3ClFNO2Purity:98%Color and Shape:SolidMolecular weight:175.5449Ref: IN-DA003N5R
1g56.00€5g108.00€10g142.00€1kgTo inquire25g229.00€50g517.00€100gTo inquire250gTo inquire500gTo inquire100mg25.00€250mg26.00€6-Chloro-3-fluoropicolinic acid
CAS:6-Chloro-3-fluoropicolinic acidPurity:98%Molecular weight:175.54g/mol6-Chloro-3-fluoropicolinic acid
CAS:Formula:C6H3ClFNO2Purity:95%Color and Shape:SolidMolecular weight:175.546-chloro-3-fluoropyridine-2-carboxylic Acid
CAS:Please enquire for more information about 6-chloro-3-fluoropyridine-2-carboxylic Acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C6H3ClFNO2Purity:Min. 95%Molecular weight:175.54 g/mol




