CymitQuimica logo

CAS 884494-85-3

:

5-Choro-6-methoxynicotinic acid

Description:
5-Chloro-6-methoxynicotinic acid is a chemical compound belonging to the class of nicotinic acids, which are derivatives of pyridine. It features a chloro group at the 5-position and a methoxy group at the 6-position of the pyridine ring, contributing to its unique chemical properties. This compound is characterized by its ability to participate in various chemical reactions due to the presence of both the carboxylic acid functional group and the heterocyclic aromatic system. It is typically a white to off-white solid and is soluble in polar solvents, which enhances its utility in various applications, including pharmaceuticals and agrochemicals. The presence of the chlorine and methoxy substituents can influence its biological activity, making it a subject of interest in medicinal chemistry for potential therapeutic uses. Additionally, its molecular structure allows for interactions with biological targets, which may lead to various pharmacological effects. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H6ClNO3
InChI:InChI=1/C7H6ClNO3/c1-12-6-5(8)2-4(3-9-6)7(10)11/h2-3H,1H3,(H,10,11)
InChI key:FUBFUAARMGZWPE-UHFFFAOYSA-N
SMILES:COc1c(cc(cn1)C(=O)O)Cl
Synonyms:
  • 5-Chloro-6-Methoxynicotinic Acid
Found 4 products.