CAS 884494-97-7

6-Fluoro-2-methyl-3-pyridinecarboxylic acid

Description:

6-Fluoro-2-methyl-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 6-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound features a carboxylic acid functional group at the 3-position, which imparts acidic characteristics and enhances its reactivity. The fluorine substituent can influence the compound's polarity, solubility, and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the carboxylic acid group allows for potential interactions in various chemical reactions, such as esterification or amidation. Overall, 6-Fluoro-2-methyl-3-pyridinecarboxylic acid is notable for its structural features that may contribute to its utility in pharmaceutical applications and as a building block in organic synthesis.

Formula: C₇H₆FNO₂

InChI: InChI=1S/C7H6FNO2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=PHENIYTVOJTIOS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C)N=C(F)C=C1

Synonyms:

• 3-Pyridinecarboxylic acid, 6-fluoro-2-methyl-
• 6-Fluoro-2-Methyl-Pyridine-3-Carboxylic Acid
• 6-Fluoro-2-methyl-3-pyridinecarboxylic acid
• 6-Fluoro-2-methylnicotinic acid

6-Fluoro-2-methylnicotinic acid

CAS: 884494-97-7

Formula: C₇H₆FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 155.1264

Ref: IN-DA004EM9

6-Fluoro-2-methylnicotinic acid

CAS: 884494-97-7

6-Fluoro-2-methylnicotinic acid

Purity: 98%

Molecular weight: 155.13g/mol

Ref: 54-PC900652

6-Fluoro-2-methylnicotinic acid

CAS: 884494-97-7

Formula: C₇H₆FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 155.128

Ref: 10-F033575