CAS 884495-03-8
:3-Amino-2-bromo-5-fluoropyridine
Description:
3-Amino-2-bromo-5-fluoropyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with an amino group, a bromine atom, and a fluorine atom at specific positions. The molecular structure features a six-membered aromatic ring containing five carbon atoms and one nitrogen atom, which contributes to its basicity and reactivity. The amino group (-NH2) enhances its potential for hydrogen bonding and increases its solubility in polar solvents. The bromine and fluorine substituents introduce significant electronegativity, influencing the compound's reactivity and interaction with other chemical species. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.
Formula:C5H4BrFN2
InChI:InChI=1/C5H4BrFN2/c6-5-4(8)1-3(7)2-9-5/h1-2H,8H2
SMILES:c1c(cnc(c1N)Br)F
Synonyms:- 2-Bromo-5-fluoropyridin-3-amine
- 3-Pyridinamine, 2-bromo-5-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-2-bromo-5-fluoropyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H4BrFN2Purity:97%Color and Shape:White to pale pink to pale brown, PowderMolecular weight:191.03-Amino-2-bromo-5-fluoropyridine
CAS:Formula:C5H4BrFN2Purity:98%Color and Shape:SolidMolecular weight:191.0011Ref: IN-DA0036BG
1kgTo inquire100gTo inquire250gTo inquire500gTo inquire100mg21.00€250mg25.00€1g30.00€5g77.00€10g114.00€25g196.00€50g329.00€3-Amino-2-bromo-5-fluoropyridine
CAS:3-Amino-2-bromo-5-fluoropyridineFormula:C5H4BrFN2Purity:98%Color and Shape: white to off-white solidMolecular weight:191.00g/mol3-Amino-2-bromo-5-fluoropyridine
CAS:Formula:C5H4BrFN2Purity:98%Color and Shape:Solid, Pale yellow powderMolecular weight:191.003



