CAS 884495-14-1

5-Bromo-2-methoxy-3-nitro-4-picoline

Description:

5-Bromo-2-methoxy-3-nitro-4-picoline is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of a bromine atom, a methoxy group, and a nitro group contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting its non-polar characteristics. It is often used in synthetic organic chemistry as an intermediate for the production of pharmaceuticals or agrochemicals. The nitro group can participate in electrophilic aromatic substitution reactions, while the methoxy group can influence the compound's reactivity and polarity. Additionally, the bromine substituent can serve as a site for further chemical modifications. Safety precautions should be observed when handling this compound, as it may pose health risks due to its potential toxicity and reactivity. Overall, 5-Bromo-2-methoxy-3-nitro-4-picoline is a valuable compound in research and industrial applications, particularly in the fields of medicinal chemistry and materials science.

Formula: C₇H₇BrN₂O₃

InChI: InChI=1/C7H7BrN2O3/c1-4-5(8)3-9-7(13-2)6(4)10(11)12/h3H,1-2H3

SMILES: Cc1c(cnc(c1N(=O)=O)OC)Br

Synonyms:

• 5-Bromo-2-methoxy-4-methyl-3-nitropyridine

5-Bromo-2-methoxy-4-methyl-3-nitropyridine

CAS: 884495-14-1

Formula: C₇H₇BrN₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 247.0461

Ref: IN-DA004EM6

5-Bromo-2-methoxy-4-methyl-3-nitropyridine

CAS: 884495-14-1

5-Bromo-2-methoxy-4-methyl-3-nitropyridine

Formula: C₇H₇BrN₂O₃

Purity: ≥95%

Color and Shape: light gold crystalline powder / crystals

Molecular weight: 247.05g/mol

Ref: 54-OR41181

5-Bromo-2-methoxy-4-methyl-3-nitropyridine

CAS: 884495-14-1

Formula: C₇H₇BrN₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 247.048

Ref: 10-F036247