CAS 884495-15-2

5-Bromo-2-chloro-4-methyl-3-nitropyridine

Description:

5-Bromo-2-chloro-4-methyl-3-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features several substituents: a bromine atom at the 5-position, a chlorine atom at the 2-position, a methyl group at the 4-position, and a nitro group at the 3-position. These functional groups contribute to its chemical reactivity and physical properties. The presence of halogens (bromine and chlorine) and a nitro group can enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure makes it of interest in medicinal chemistry and materials science, where it may serve as a precursor for the synthesis of more complex molecules or as a potential pharmaceutical agent. Safety precautions should be taken when handling this compound due to the presence of halogens and the nitro group, which can pose health risks.

Formula: C₆H₄BrClN₂O₂

InChI: InChI=1S/C6H4BrClN2O2/c1-3-4(7)2-9-6(8)5(3)10(11)12/h2H,1H3

InChI key: InChIKey=BLJOCKNDWUTFEN-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(C)=C(Br)C=NC1Cl

Synonyms:

• 2-Bromo-6-Chloro-3-Methyl-5-Nitropyridine
• 5-Bromo-2-Chloro-3-Nitro-4-Picoline
• 5-Bromo-2-Chloro-4-Methyl-3-Nitro-Pyridine
• Pyridine, 5-bromo-2-chloro-4-methyl-3-nitro-
• 5-Bromo-2-chloro-4-methyl-3-nitropyridine

5-Bromo-2-chloro-4-methyl-3-nitropyridine

CAS: 884495-15-2

Formula: C₆H₄BrClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 251.4652

Ref: IN-DA0038DN

5-Bromo-2-chloro-4-methyl-3-nitropyridine

CAS: 884495-15-2

5-Bromo-2-chloro-4-methyl-3-nitropyridine

Formula: C₆H₄BrClN₂O₂

Purity: 98%

Color and Shape: beige solid

Molecular weight: 251.47g/mol

Ref: 54-OR2915

5-Bromo-2-chloro-4-methyl-3-nitropyridine

CAS: 884495-15-2

Formula: C₆H₄BrClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 251.46

Ref: 10-F049706