CymitQuimica logo

CAS 884495-19-6

:

2-Amino-3-iodo-6-methylpyridine

Description:
2-Amino-3-iodo-6-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with an amino group, an iodine atom, and a methyl group. The presence of the amino group (-NH2) contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions. The iodine atom introduces significant electronegativity and can influence the compound's reactivity and stability, making it a useful intermediate in organic synthesis. The methyl group enhances the lipophilicity of the molecule, which can affect its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features allow for potential applications in the synthesis of pharmaceuticals, agrochemicals, and other functional materials. As with many halogenated compounds, safety precautions should be taken when handling 2-amino-3-iodo-6-methylpyridine due to the potential for toxicity and environmental impact.
Formula:C6H7IN2
InChI:InChI=1S/C6H7IN2/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3,(H2,8,9)
InChI key:QOAIVYVMHSWJDH-UHFFFAOYSA-N
SMILES:CC1=NC(=C(C=C1)I)N
Found 5 products.