CAS 884495-39-0
:5-bromo-2-methoxy-pyridin-3-amine
Description:
5-Bromo-2-methoxy-pyridin-3-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxy group at the 2-position, along with an amino group at the 3-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents due to the presence of the methoxy and amino functional groups. It may exhibit basic properties due to the amino group, which can accept protons. The bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions. 5-Bromo-2-methoxy-pyridin-3-amine is of interest in medicinal chemistry and material science, potentially serving as a building block for the synthesis of pharmaceuticals or agrochemicals. Its reactivity and functional groups make it suitable for further chemical modifications, allowing for the exploration of its biological activity and applications in various fields.
Formula:C6H7BrN2O
InChI:InChI=1/C6H7BrN2O/c1-10-6-5(8)2-4(7)3-9-6/h2-3H,8H2,1H3
SMILES:COc1c(cc(cn1)Br)N
Synonyms:- 3-Pyridinamine, 5-Bromo-2-Methoxy-
- 5-Bromo-2-methoxypyridin-3-amine
- 5-Bromo-2-methoxy-3-pyridinamine
- 3-Amino-5-bromo-2-methoxypyridine
- 5-Bromo-2-Methoxy-3-Cyanopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-5-bromo-2-methoxypyridine, 96%
CAS:3-Amino-5-bromo-2-methoxypyridine is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKUFormula:C6H7BrN2OPurity:96%Molecular weight:203.045-bromo-2-methoxypyridin-3-amine
CAS:Formula:C6H7BrN2OPurity:98%Color and Shape:SolidMolecular weight:203.03663-Amino-5-bromo-2-methoxypyridine
CAS:3-Amino-5-bromo-2-methoxypyridinePurity:97%Color and Shape:SolidMolecular weight:203.04g/mol5-Bromo-2-methoxypyridin-3-amine
CAS:Formula:C6H7BrN2OPurity:97%Color and Shape:SolidMolecular weight:203.039




