CAS 884497-30-7

2-amino-5-methyl-4-[4-(1-methylpropyl)phenyl]thiophene-3-carbonitrile

Description:

2-amino-5-methyl-4-[4-(1-methylpropyl)phenyl]thiophene-3-carbonitrile, with the CAS number 884497-30-7, is a synthetic organic compound characterized by its complex structure, which includes a thiophene ring, an amino group, and a carbonitrile functional group. This compound features a branched alkyl substituent (1-methylpropyl) and a phenyl group, contributing to its potential as a versatile building block in organic synthesis. The presence of the amino group suggests that it may exhibit basic properties, while the carbonitrile group can impart polar characteristics, influencing its solubility and reactivity. The thiophene moiety is known for its stability and ability to participate in various chemical reactions, making this compound of interest in materials science and medicinal chemistry. Its unique structure may also confer specific biological activities, warranting further investigation for potential applications in pharmaceuticals or agrochemicals. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various chemical contexts.

Formula: C₁₆H₁₈N₂S

InChI: InChI=1/C16H18N2S/c1-4-10(2)12-5-7-13(8-6-12)15-11(3)19-16(18)14(15)9-17/h5-8,10H,4,18H2,1-3H3

SMILES: CCC(C)c1ccc(cc1)c1c(C)sc(c1C#N)N

Synonyms:

• 2-Amino-4-(4-sec-butylphenyl)-5-methylthiophene-3-carbonitrile
• 3-Thiophenecarbonitrile, 2-Amino-5-Methyl-4-[4-(1-Methylpropyl)Phenyl]-

2-amino-4-(4-sec-butylphenyl)-5-methylthiophene-3-carbonitrile

CAS: 884497-30-7

Formula: C₁₆H₁₈N₂S

Purity: 95.0%

Molecular weight: 270.39

Ref: 10-F307427