CAS 884497-31-8

2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carbonitrile

Description:

2-Amino-4-(3,4-dimethoxyphenyl)thiophene-3-carbonitrile is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a cyano group (-C≡N) attached to the thiophene, contributing to its reactivity and potential biological activity. The presence of the 3,4-dimethoxyphenyl substituent enhances its electronic properties and solubility, making it of interest in various chemical applications, including pharmaceuticals and organic electronics. The methoxy groups (-OCH3) can influence the compound's polarity and interaction with biological targets. Additionally, the compound's structure suggests potential for hydrogen bonding and π-π stacking interactions, which are important in drug design and material science. Its CAS number, 884497-31-8, allows for precise identification in chemical databases, facilitating research and development in synthetic chemistry and related fields. Overall, this compound exemplifies the complexity and versatility of organic molecules in modern chemistry.

Formula: C₁₃H₁₂N₂O₂S

InChI: InChI=1/C13H12N2O2S/c1-16-11-4-3-8(5-12(11)17-2)10-7-18-13(15)9(10)6-14/h3-5,7H,15H2,1-2H3

SMILES: COc1ccc(cc1OC)c1csc(c1C#N)N

Synonyms:

• 3-Thiophenecarbonitrile, 2-Amino-4-(3,4-Dimethoxyphenyl)-
• 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carbonitrile(SALTDATA: FREE)
• 2-AMINO-4-(3,4-DIMETHOXYPHENYL)THIOPHENE-3-CARBONITRILE
• IVK/0049084

2-Amino-4-(3,4-dimethoxyphenyl)thiophene-3-carbonitrile

CAS: 884497-31-8

Formula: C₁₃H₁₂N₂O₂S

Molecular weight: 260.3116

Ref: IN-DA008CN3

2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carbonitrile

CAS: 884497-31-8

Formula: C₁₃H₁₂N₂O₂S

Purity: 95.0%

Molecular weight: 260.31

Ref: 10-F307428