CAS 884497-34-1

4-Ethyl-5-methyl-3-thiophenecarboxylic acid

Description:

4-Ethyl-5-methyl-3-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features an ethyl group and a methyl group as substituents on the thiophene ring, specifically at the 4 and 5 positions, respectively, while the carboxylic acid functional group is located at the 3 position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The carboxylic acid group imparts acidic properties, allowing for hydrogen bonding and solubility in polar solvents. Additionally, the thiophene ring enhances the compound's stability and electronic properties, making it suitable for use in organic electronics and as a building block in synthetic chemistry. Overall, 4-Ethyl-5-methyl-3-thiophenecarboxylic acid is a versatile compound with unique structural features that influence its chemical behavior and potential applications.

Formula: C₈H₁₀O₂S

InChI: InChI=1S/C8H10O2S/c1-3-6-5(2)11-4-7(6)8(9)10/h4H,3H2,1-2H3,(H,9,10)

InChI key: InChIKey=PLGXACUSGWZNKZ-UHFFFAOYSA-N

SMILES: C(C)C=1C(C(O)=O)=CSC1C

Synonyms:

• 3-Thiophenecarboxylic Acid, 4-Ethyl-5-Methyl-
• 4-Ethyl-5-methyl-3-thiophenecarboxylic acid

4-Ethyl-5-methylthiophene-3-carboxylic acid

CAS: 884497-34-1

4-Ethyl-5-methylthiophene-3-carboxylic acid is a chemical compound that can be used as an intermediate for the synthesis of other compounds. It is also a building block and a versatile building block in organic synthesis, with many applications in research and industry. This compound has a CAS number of 884497-34-1 and is classified as a speciality chemical.

Formula: C₈H₁₀O₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 170.23 g/mol

Ref: 3D-FE112785