CAS 884497-36-3
:methyl 2-amino-5-(1-phenylethyl)thiophene-3-carboxylate
Description:
Methyl 2-amino-5-(1-phenylethyl)thiophene-3-carboxylate, identified by its CAS number 884497-36-3, is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group and a carboxylate ester, contributing to its potential reactivity and solubility in various solvents. The presence of the phenylethyl group enhances its hydrophobic characteristics, which may influence its biological activity and interaction with other molecules. Methyl 2-amino-5-(1-phenylethyl)thiophene-3-carboxylate may exhibit properties such as moderate to high melting points and stability under standard laboratory conditions. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with biological activity, such as anti-inflammatory or analgesic agents. Additionally, the compound's functional groups may allow for further chemical modifications, making it a versatile candidate for synthetic chemistry and medicinal research.
Formula:C14H15NO2S
InChI:InChI=1/C14H15NO2S/c1-9(10-6-4-3-5-7-10)12-8-11(13(15)18-12)14(16)17-2/h3-9H,15H2,1-2H3
SMILES:CC(c1ccccc1)c1cc(c(N)s1)C(=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.