CAS 884497-37-4

Ethyl 2-amino-5-(1-phenylethyl)-3-thiophenecarboxylate

Description:

Ethyl 2-amino-5-(1-phenylethyl)-3-thiophenecarboxylate, with the CAS number 884497-37-4, is a chemical compound characterized by its unique structure that includes an ethyl ester group, an amino group, and a thiophene ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in organic solvents. The presence of the thiophene moiety may impart specific electronic properties, making it of interest in various applications, including pharmaceuticals and organic synthesis. The amino group can participate in hydrogen bonding, influencing its interaction with other molecules. Additionally, the phenylethyl substituent can enhance the compound's lipophilicity, affecting its biological activity and transport properties. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its specific physical and chemical properties, as well as its biological activity, would be necessary to fully understand its applications and behavior in various environments.

Formula: C₁₅H₁₇NO₂S

InChI: InChI=1/C15H17NO2S/c1-3-18-15(17)12-9-13(19-14(12)16)10(2)11-7-5-4-6-8-11/h4-10H,3,16H2,1-2H3

InChI key: InChIKey=DIXRCLQTPWTGBC-UHFFFAOYSA-N

SMILES: C(C)(C1=CC(C(OCC)=O)=C(N)S1)C2=CC=CC=C2

Synonyms:

• 3-Thiophenecarboxylic Acid, 2-Amino-5-(1-Phenylethyl)-, Ethyl Ester
• Ethyl 2-amino-5-(1-phenylethyl)-3-thiophenecarboxylate

ethyl 2-amino-5-(1-phenylethyl)thiophene-3-carboxylate

CAS: 884497-37-4

Formula: C₁₅H₁₇NO₂S

Purity: 95.0%

Molecular weight: 275.37

Ref: 10-F307442