CAS 884497-42-1

4-Methoxy-N-(3-methoxypropyl)benzenemethanamine

Description:

4-Methoxy-N-(3-methoxypropyl)benzenemethanamine, with the CAS number 884497-42-1, is an organic compound characterized by its aromatic structure and the presence of methoxy groups. This compound features a benzene ring substituted with a methoxy group at the para position and an amine group that is linked to a propyl chain, which also contains a methoxy substituent. The presence of these functional groups suggests that the compound may exhibit properties such as moderate polarity and potential for hydrogen bonding, which can influence its solubility in various solvents. Additionally, the methoxy groups can enhance the compound's lipophilicity, potentially affecting its biological activity and interactions with other molecules. The amine functionality may also impart basic properties, allowing for protonation under acidic conditions. Overall, this compound's unique structure may lead to interesting chemical reactivity and applications in fields such as medicinal chemistry or materials science, although specific biological or pharmacological data would require further investigation.

Formula: C₁₂H₁₉NO₂

InChI: InChI=1/C12H19NO2/c1-14-9-3-8-13-10-11-4-6-12(15-2)7-5-11/h4-7,13H,3,8-10H2,1-2H3

InChI key: InChIKey=PTFWYICRTCPUQP-UHFFFAOYSA-N

SMILES: C(NCCCOC)C1=CC=C(OC)C=C1

Synonyms:

• Benzenemethanamine, 4-methoxy-N-(3-methoxypropyl)-
• 4-Methoxy-N-(3-methoxypropyl)benzenemethanamine