CymitQuimica logo

CAS 884497-44-3

:

3-methoxy-N-(3-methoxybenzyl)propan-1-amine

Description:
3-Methoxy-N-(3-methoxybenzyl)propan-1-amine is an organic compound characterized by its amine functional group and methoxy substituents. It features a propan-1-amine backbone, which is a three-carbon chain with an amine group (-NH2) at one end. The presence of two methoxy groups (-OCH3) enhances its solubility in organic solvents and may influence its biological activity. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the aromatic ring and the amine functionality, which can participate in various chemical reactions and interactions. Its molecular interactions may be influenced by the steric and electronic effects of the methoxy groups, potentially affecting its binding affinity to biological targets. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in a laboratory setting to fully understand its properties and applications. As with any chemical substance, proper safety protocols should be followed when handling it in research or industrial contexts.
Formula:C12H19NO2
InChI:InChI=1/C12H19NO2/c1-14-8-4-7-13-10-11-5-3-6-12(9-11)15-2/h3,5-6,9,13H,4,7-8,10H2,1-2H3
SMILES:COCCCNCc1cccc(c1)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.