CAS 884497-47-6

2,4,5,6-Tetrahydro-3-cyclopentapyrazolecarboxylic acid

Description:

2,4,5,6-Tetrahydro-3-cyclopentapyrazolecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a cyclopentane moiety. This compound features multiple functional groups, including a carboxylic acid, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the tetrahydro configuration indicates that the compound is saturated, which can influence its physical properties such as solubility and boiling point. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with biological targets, and its derivatives may be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the pyrazole and cyclopentane rings. Overall, 2,4,5,6-Tetrahydro-3-cyclopentapyrazolecarboxylic acid represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₇H₈N₂O₂

InChI: InChI=1S/C7H8N2O2/c10-7(11)6-4-2-1-3-5(4)8-9-6/h1-3H2,(H,8,9)(H,10,11)

InChI key: InChIKey=FCYBBDFUBSEGMX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NN1)CCC2

Synonyms:

• 2H,4H,5H,6H-Cyclopenta[c]pyrazole-3-carboxylic acid
• 2,4,5,6-Tetrahydro-3-cyclopentapyrazolecarboxylic acid
• 3-Cyclopentapyrazolecarboxylic acid, 2,4,5,6-tetrahydro-

3-Cyclopentapyrazolecarboxylic acid, 2,4,5,6-tetrahydro-

CAS: 884497-47-6

Formula: C₇H₈N₂O₂

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA004EJ6

2,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid

CAS: 884497-47-6

Formula: C₇H₈N₂O₂

Purity: 96%

Molecular weight: 152.153

Ref: 10-F512588