CAS 884497-50-1
:N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine
Description:
N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine, with the CAS number 884497-50-1, is a chemical compound characterized by its complex structure, which includes a tetrahydronaphthalene moiety and a pyridine ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. Its molecular structure suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. The presence of the pyridine ring may contribute to its solubility in polar solvents and influence its reactivity. Additionally, the tetrahydronaphthalene portion may impart hydrophobic characteristics, affecting its overall pharmacokinetic profile. This compound may be studied for its potential applications in drug development, particularly in the context of neuropharmacology or as a scaffold for synthesizing more complex molecules. As with many organic compounds, its stability, reactivity, and biological activity would depend on various factors, including environmental conditions and the presence of other chemical species.
Formula:C16H18N2
InChI:InChI=1/C16H18N2/c1-2-6-15-14(4-1)5-3-7-16(15)18-12-13-8-10-17-11-9-13/h1-2,4,6,8-11,16,18H,3,5,7,12H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(PYRIDIN-4-YLMETHYL)1,2,3,4-TETRAHYDRONAPHTHALEN-1-YLAMINE
CAS:Formula:C16H18N2Molecular weight:238.3275
