CAS 884497-52-3

[(6-chloropyrazin-2-yl)sulfanyl]acetic acid

Description:

[(6-chloropyrazin-2-yl)sulfanyl]acetic acid is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a chlorine atom and a sulfanyl (thio) group linked to an acetic acid moiety. The presence of the chloropyrazine structure contributes to its potential biological activity, as pyrazine derivatives are often explored for their pharmacological properties. The sulfanyl group introduces a thiol functionality, which can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can also engage in hydrogen bonding. Its molecular interactions may be influenced by the electron-withdrawing nature of the chlorine atom, affecting its reactivity and stability. Overall, [(6-chloropyrazin-2-yl)sulfanyl]acetic acid represents a compound of interest in medicinal chemistry and materials science, with potential applications in drug development and synthesis.

Formula: C₆H₅ClN₂O₂S

InChI: InChI=1/C6H5ClN2O2S/c7-4-1-8-2-5(9-4)12-3-6(10)11/h1-2H,3H2,(H,10,11)

SMILES: c1c(Cl)nc(cn1)SCC(=O)O

[(6-chloropyrazin-2-yl)thio]acetic acid

CAS: 884497-52-3

Formula: C₆H₅ClN₂O₂S

Purity: 95.0%

Molecular weight: 204.63

Ref: 10-F314450