CAS 884497-63-6

8-hydroxy-5-nitroquinoline-2-carbaldehyde

Description:

8-Hydroxy-5-nitroquinoline-2-carbaldehyde is a chemical compound characterized by its quinoline structure, which features a hydroxyl group and a nitro group at specific positions on the ring. This compound typically exhibits properties such as being a yellow to orange crystalline solid, with potential applications in various fields, including medicinal chemistry and materials science. The presence of the hydroxyl group contributes to its ability to form hydrogen bonds, enhancing its solubility in polar solvents. The nitro group can influence the compound's reactivity and electronic properties, making it a candidate for further chemical modifications. Additionally, the aldehyde functional group is reactive, allowing for potential interactions with other nucleophiles. This compound may also exhibit fluorescence, which can be useful in biological imaging or as a dye. Overall, 8-hydroxy-5-nitroquinoline-2-carbaldehyde is of interest for its unique structural features and potential utility in various chemical applications.

Formula: C₁₀H₆N₂O₄

InChI: InChI=1/C10H6N2O4/c13-5-6-1-2-7-8(12(15)16)3-4-9(14)10(7)11-6/h1-5,14H

SMILES: c1cc2c(ccc(c2nc1C=O)O)N(=O)=O

8-Hydroxy-5-nitroquinoline-2-carbaldehyde

CAS: 884497-63-6

Formula: C₁₀H₆N₂O₄

Purity: %

Color and Shape: Solid

Molecular weight: 218.1656

Ref: IN-DA004EIZ

8-Hydroxy-5-nitroquinoline-2-carbaldehyde

CAS: 884497-63-6

8-Hydroxy-5-nitroquinoline-2-carbaldehyde

Purity: 95%

Molecular weight: 218.17g/mol

Ref: 54-OR1064964

8-Hydroxy-5-nitroquinoline-2-carbaldehyde

CAS: 884497-63-6

8-Hydroxy-5-nitroquinoline-2-carbaldehyde is a high quality, versatile building block that can be used as a reaction intermediate or to synthesize heterocycles. It is also a useful scaffold for the synthesis of complex compounds. The CAS number of this chemical is 884497-63-6.

Formula: C₁₀H₆N₂O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 218.17 g/mol

Ref: 3D-FH135078