CAS 884497-65-8

2-[(3-Formyl-6-methoxy-2-quinolinyl)thio]acetic acid

Description:

2-[(3-Formyl-6-methoxy-2-quinolinyl)thio]acetic acid is a chemical compound characterized by its unique structure, which includes a quinoline moiety, a formyl group, and a thioacetic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the quinoline ring, which is known for its pharmacological significance. The methoxy group contributes to the compound's lipophilicity, potentially influencing its solubility and reactivity. The thioacetic acid portion may impart acidic characteristics, allowing for interactions with various biological targets. Additionally, the presence of the formyl group suggests potential reactivity in condensation reactions or as a site for further functionalization. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for novel therapeutic agents. Its specific applications and biological activities would require further investigation through experimental studies.

Formula: C₁₃H₁₁NO₄S

InChI: InChI=1S/C13H11NO4S/c1-18-10-2-3-11-8(5-10)4-9(6-15)13(14-11)19-7-12(16)17/h2-6H,7H2,1H3,(H,16,17)

InChI key: InChIKey=VDHAXZSRBIEISQ-UHFFFAOYSA-N

SMILES: C(=O)C1=CC2=C(N=C1SCC(O)=O)C=CC(OC)=C2

Synonyms:

• Acetic acid, [(3-formyl-6-methoxy-2-quinolinyl)thio]-
• 2-[(3-Formyl-6-methoxy-2-quinolinyl)thio]acetic acid
• Acetic acid, 2-[(3-formyl-6-methoxy-2-quinolinyl)thio]-