CAS 884497-66-9

2-[[2-[(1-Bromo-2-naphthalenyl)oxy]ethyl]amino]ethanol

Description:

2-[[2-[(1-Bromo-2-naphthalenyl)oxy]ethyl]amino]ethanol, with the CAS number 884497-66-9, is a chemical compound characterized by its complex structure, which includes a naphthalene moiety substituted with a bromine atom. This compound features an ether linkage and an amino alcohol functional group, contributing to its potential reactivity and solubility properties. The presence of the naphthalene ring suggests that it may exhibit aromatic characteristics, which can influence its electronic properties and interactions with other molecules. The amino and hydroxyl groups can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the bromine atom may impart specific reactivity, making it a candidate for various chemical transformations. This compound may be of interest in medicinal chemistry or materials science due to its unique structural features, which could lead to specific biological activities or applications in synthesis. As with any chemical substance, safety and handling precautions should be observed, given the potential hazards associated with brominated compounds and aromatic systems.

Formula: C₁₄H₁₆BrNO₂

InChI: InChI=1S/C14H16BrNO2/c15-14-12-4-2-1-3-11(12)5-6-13(14)18-10-8-16-7-9-17/h1-6,16-17H,7-10H2

InChI key: InChIKey=QYNCHTUAIQQTHU-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=CC1OCCNCCO)C=CC=C2

Synonyms:

• 2-[[2-[(1-Bromo-2-naphthalenyl)oxy]ethyl]amino]ethanol
• Ethanol, 2-[[2-[(1-bromo-2-naphthalenyl)oxy]ethyl]amino]-

2-({2-[(1-bromo-2-naphthyl)oxy]ethyl}amino)ethanol

CAS: 884497-66-9

Formula: C₁₄H₁₆BrNO₂

Purity: 95.0%

Molecular weight: 310.191

Ref: 10-F315296