CAS 884497-70-5

N-benzyl-2-(2-fluorophenoxy)ethanamine

Description:

N-benzyl-2-(2-fluorophenoxy)ethanamine is an organic compound characterized by its structural features, which include a benzyl group and a 2-fluorophenoxy moiety attached to an ethanamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The fluorine atom in the 2-fluorophenoxy group can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. N-benzyl-2-(2-fluorophenoxy)ethanamine may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. As with many organic compounds, safety and handling precautions should be observed, particularly when dealing with amines and halogenated compounds, as they may pose health risks or environmental concerns.

Formula: C₁₅H₁₆FNO

InChI: InChI=1/C15H16FNO/c16-14-8-4-5-9-15(14)18-11-10-17-12-13-6-2-1-3-7-13/h1-9,17H,10-12H2

SMILES: c1ccc(cc1)CNCCOc1ccccc1F