CAS 884500-72-5
:2-(4-hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-one
Description:
2-(4-Hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-one, with the CAS number 884500-72-5, is a chemical compound characterized by its complex bicyclic structure that includes a pyran and pyridine moiety. This compound features a hydroxyl group attached to a phenyl ring, which contributes to its potential biological activity. The presence of the hydroxyl group may enhance its solubility in polar solvents and influence its reactivity and interaction with biological targets. The compound is of interest in medicinal chemistry due to its potential pharmacological properties, including antioxidant and anti-inflammatory activities. Its structural features suggest that it may participate in various chemical reactions, such as hydrogen bonding and π-π stacking interactions, which are important in biological systems. Additionally, the compound's unique structure may allow for the exploration of its derivatives, potentially leading to the development of new therapeutic agents. Overall, 2-(4-hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-one represents a fascinating subject for further research in both synthetic and medicinal chemistry.
Formula:C14H9NO3
InChI:InChI=1/C14H9NO3/c16-10-5-3-9(4-6-10)13-8-12(17)11-2-1-7-15-14(11)18-13/h1-8,16H
Synonyms:- 2-(4-Hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-on
- 4H-pyrano[2,3-b]pyridin-4-one, 2-(4-hydroxyphenyl)-
- 3-b]pyridin-4-one
- 2-(4-hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-one
- 2-(4-hydroxyphenyl)-
- 2-(4-Hydroxyphenyl)pyrano[2,3-b]pyridin-4-one
- 4H-Pyrano[2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
