CAS 884504-24-9
:1-(2,3-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone
Description:
1-(2,3-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone, identified by its CAS number 884504-24-9, is an organic compound characterized by its unique molecular structure that includes a propanone moiety and a dioxane ring. The presence of the difluorophenyl group suggests that it may exhibit interesting electronic properties and potential reactivity due to the electronegative fluorine atoms. This compound is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions and crystallization behavior. Its dioxane component may contribute to solubility in polar solvents, while the propanone group can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's potential applications could span fields such as pharmaceuticals, agrochemicals, or materials science, where its unique structure may impart specific biological or chemical activities. However, detailed studies would be necessary to fully elucidate its properties, reactivity, and potential uses in various applications.
Formula:C13H14F2O3
InChI:InChI=1/C13H14F2O3/c14-10-4-1-3-9(13(10)15)11(16)5-6-12-17-7-2-8-18-12/h1,3-4,12H,2,5-8H2
InChI key:InChIKey=DSMIANQLEJVFFK-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=C(F)C(F)=CC=C2
Synonyms:- 1-(2,3-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone
- 1-Propanone, 1-(2,3-Difluorophenyl)-3-(1,3-Dioxan-2-Yl)-
- 2',3'-DIFLUORO-3-(1,3-DIOXAN-2-YL)PROPIOPHENONE
- 1-(2,3-difluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.