CymitQuimica logo

CAS 884504-25-0

:

1-(2,4-difluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one

Description:
1-(2,4-Difluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one, with the CAS number 884504-25-0, is an organic compound characterized by its unique structure that includes a propanone moiety linked to a 2,4-difluorophenyl group and a 1,3-dioxane ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and solubility. The presence of fluorine atoms in the phenyl ring can enhance lipophilicity and alter electronic properties, potentially affecting its biological activity. The dioxane ring contributes to the compound's stability and may participate in hydrogen bonding interactions. As a ketone, it may undergo typical reactions such as nucleophilic addition and oxidation. The compound's specific applications and behavior in various chemical environments would depend on its functional groups and overall molecular structure, making it of interest in fields such as medicinal chemistry and materials science. Safety and handling considerations should be taken into account due to the presence of fluorinated compounds, which can have unique environmental and health implications.
Formula:C13H14F2O3
InChI:InChI=1/C13H14F2O3/c14-9-2-3-10(11(15)8-9)12(16)4-5-13-17-6-1-7-18-13/h2-3,8,13H,1,4-7H2
SMILES:C1COC(CCC(=O)c2ccc(cc2F)F)OC1
Synonyms:
  • 1-Propanone, 1-(2,4-Difluorophenyl)-3-(1,3-Dioxan-2-Yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.