CAS 884504-27-2

1-(2,6-difluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one

Description:

1-(2,6-Difluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one, with the CAS number 884504-27-2, is an organic compound characterized by its unique structural features. It contains a propanone functional group, which is indicative of ketones, and is substituted with a 2,6-difluorophenyl group, contributing to its potential reactivity and biological activity. The presence of a 1,3-dioxane ring adds to its complexity, providing a cyclic ether structure that can influence solubility and stability. This compound is likely to exhibit moderate polarity due to the combination of fluorine atoms, which can enhance its lipophilicity, and the dioxane moiety, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can lead to enhanced efficacy or selectivity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment.

Formula: C₁₃H₁₄F₂O₃

InChI: InChI=1/C13H14F2O3/c14-9-3-1-4-10(15)13(9)11(16)5-6-12-17-7-2-8-18-12/h1,3-4,12H,2,5-8H2

SMILES: c1cc(c(c(c1)F)C(=O)CCC1OCCCO1)F

Synonyms:

• 1-(2,6-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone
• 1-(2,6-Difluorphenyl)-3-(1,3-dioxan-2-yl)-1-propanon
• 1-Propanone, 1-(2,6-Difluorophenyl)-3-(1,3-Dioxan-2-Yl)-