CAS 884504-28-3
:1-(3,4-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone
Description:
1-(3,4-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone, with the CAS number 884504-28-3, is an organic compound characterized by its unique structure that includes a propanone moiety and a dioxane ring. The presence of the difluorophenyl group contributes to its potential reactivity and biological activity, as fluorine atoms can significantly influence the electronic properties of the molecule. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, which may affect its solubility in organic solvents. The dioxane ring introduces a cyclic ether functionality, which can enhance the compound's stability and influence its interaction with biological targets. Additionally, the compound may possess interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its applications could span various fields, including pharmaceuticals and agrochemicals. However, specific safety and handling guidelines should be followed due to the presence of fluorinated groups.
Formula:C13H14F2O3
InChI:InChI=1/C13H14F2O3/c14-10-3-2-9(8-11(10)15)12(16)4-5-13-17-6-1-7-18-13/h2-3,8,13H,1,4-7H2
InChI key:InChIKey=WZYPVXLPRGTFTG-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=CC(F)=C(F)C=C2
Synonyms:- 1-(3,4-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone
- 1-Propanone, 1-(3,4-Difluorophenyl)-3-(1,3-Dioxan-2-Yl)-
- 1-(3,4-Difluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
