CymitQuimica logo

CAS 884504-29-4

:

1-(3,5-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone

Description:
1-(3,5-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone, with the CAS number 884504-29-4, is an organic compound characterized by its unique structure that includes a propanone moiety and a dioxane ring. The presence of the 3,5-difluorophenyl group contributes to its potential reactivity and biological activity, as fluorine atoms can significantly influence the electronic properties of the molecule. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, which may affect its solubility in organic solvents. The dioxane ring can provide stability and may participate in various chemical reactions, including nucleophilic substitutions or cyclizations. Additionally, the compound may have applications in medicinal chemistry or material science, given the importance of fluorinated compounds in drug design and development. Its specific properties, such as melting point, boiling point, and reactivity, would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C13H14F2O3
InChI:InChI=1S/C13H14F2O3/c14-10-6-9(7-11(15)8-10)12(16)2-3-13-17-4-1-5-18-13/h6-8,13H,1-5H2
InChI key:InChIKey=IECPMEZZMQGHIJ-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=CC(F)=CC(F)=C2
Synonyms:
  • 1-(3,5-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone
  • 1-(3,5-Difluorphenyl)-3-(1,3-dioxan-2-yl)-1-propanon
  • 1-Propanone, 1-(3,5-Difluorophenyl)-3-(1,3-Dioxan-2-Yl)-
  • 1-(3,5-Difluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.