CymitQuimica logo

CAS 884504-30-7

:

3-(1,3-Dioxan-2-yl)-1-(4-propylphenyl)-1-propanone

Description:
3-(1,3-Dioxan-2-yl)-1-(4-propylphenyl)-1-propanone, identified by its CAS number 884504-30-7, is an organic compound characterized by its unique molecular structure that includes a dioxane ring and a propanone functional group. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature with a relatively low boiling point. Its dioxane moiety contributes to its solubility in polar solvents, while the propylphenyl group may enhance hydrophobic interactions. The presence of the dioxane ring can also influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, this compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C16H22O3
InChI:InChI=1S/C16H22O3/c1-2-4-13-5-7-14(8-6-13)15(17)9-10-16-18-11-3-12-19-16/h5-8,16H,2-4,9-12H2,1H3
InChI key:InChIKey=DRWOETXXVSOQPA-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=CC=C(CCC)C=C2
Synonyms:
  • 1-Propanone, 3-(1,3-Dioxan-2-Yl)-1-(4-Propylphenyl)-
  • 3-(1,3-Dioxan-2-yl)-1-(4-propylphenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.