CAS 884504-33-0

3-(1,3-dioxan-2-yl)-1-(2-ethoxyphenyl)propan-1-one

Description:

3-(1,3-Dioxan-2-yl)-1-(2-ethoxyphenyl)propan-1-one, with the CAS number 884504-33-0, is an organic compound characterized by its complex structure that includes a dioxane ring and an ethoxy-substituted phenyl group. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the presence of the carbonyl group, which can engage in hydrogen bonding. The dioxane moiety contributes to its solubility in organic solvents, while the ethoxyphenyl group may influence its reactivity and interaction with biological systems. The presence of both the dioxane and phenyl groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. Additionally, the compound may exhibit specific optical properties, making it of interest in materials science or photochemistry. Its stability and reactivity would depend on the surrounding conditions, such as temperature and pH, as well as the presence of other reactive species. Overall, this compound represents a unique combination of functional groups that could be explored for various chemical applications.

Formula: C₁₅H₂₀O₄

InChI: InChI=1/C15H20O4/c1-2-17-14-7-4-3-6-12(14)13(16)8-9-15-18-10-5-11-19-15/h3-4,6-7,15H,2,5,8-11H2,1H3

SMILES: CCOc1ccccc1C(=O)CCC1OCCCO1

Synonyms:

• 1-Propanone, 3-(1,3-Dioxan-2-Yl)-1-(2-Ethoxyphenyl)-