CAS 884504-34-1
:3-(1,3-Dioxan-2-yl)-1-(4-pentylphenyl)-1-propanone
Description:
3-(1,3-Dioxan-2-yl)-1-(4-pentylphenyl)-1-propanone, with the CAS number 884504-34-1, is an organic compound characterized by its unique molecular structure that includes a dioxane ring and a propanone functional group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid with a distinctive odor. It is likely to be soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the pentylphenyl group. The presence of the dioxane moiety suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as a precursor in various chemical reactions. Additionally, its structural features may impart specific reactivity patterns, making it of interest in fields such as medicinal chemistry or photochemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H26O3
InChI:InChI=1S/C18H26O3/c1-2-3-4-6-15-7-9-16(10-8-15)17(19)11-12-18-20-13-5-14-21-18/h7-10,18H,2-6,11-14H2,1H3
InChI key:InChIKey=XNMUWNLUXFLKCA-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=CC=C(CCCCC)C=C2
Synonyms:- 1-Propanone, 3-(1,3-Dioxan-2-Yl)-1-(4-Pentylphenyl)-
- 3-(1,3-Dioxan-2-yl)-1-(4-pentylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
