CAS 884504-35-2

3-(1,3-dioxan-2-yl)-1-(4-isopropoxyphenyl)propan-1-one

Description:

3-(1,3-Dioxan-2-yl)-1-(4-isopropoxyphenyl)propan-1-one, with the CAS number 884504-35-2, is an organic compound characterized by its complex structure that includes a dioxane ring and a propanone moiety. The presence of the 1,3-dioxane ring contributes to its stability and solubility in various organic solvents. The isopropoxyphenyl group enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound may exhibit interesting biological activities due to its structural features, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, would depend on the specific conditions under which it is studied. Overall, 3-(1,3-dioxan-2-yl)-1-(4-isopropoxyphenyl)propan-1-one represents a versatile chemical entity with potential applications in medicinal chemistry and material science.

Formula: C₁₆H₂₂O₄

InChI: InChI=1/C16H22O4/c1-12(2)20-14-6-4-13(5-7-14)15(17)8-9-16-18-10-3-11-19-16/h4-7,12,16H,3,8-11H2,1-2H3

SMILES: CC(C)Oc1ccc(cc1)C(=O)CCC1OCCCO1