CAS 884504-39-6
:3-(1,3-dioxan-2-yl)-1-(5-fluoro-2-methyl-phenyl)propan-1-one
Description:
3-(1,3-Dioxan-2-yl)-1-(5-fluoro-2-methyl-phenyl)propan-1-one, with the CAS number 884504-39-6, is a synthetic organic compound characterized by its complex structure that includes a dioxane ring and a substituted phenyl group. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the presence of the carbonyl group, which can influence its solubility in various solvents. The presence of the dioxane moiety may impart additional stability and solubility characteristics, while the fluorine and methyl substitutions on the phenyl ring can affect its reactivity and biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific interactions and behaviors of this compound would depend on its molecular conformation and the environment in which it is placed, making it a subject of interest in both theoretical and applied chemistry.
Formula:C14H17FO3
InChI:InChI=1/C14H17FO3/c1-10-3-4-11(15)9-12(10)13(16)5-6-14-17-7-2-8-18-14/h3-4,9,14H,2,5-8H2,1H3
SMILES:Cc1ccc(cc1C(=O)CCC1OCCCO1)F
Synonyms:- 3-(1,3-Dioxan-2-Yl)-1-(5-Fluoro-2-Methylphenyl)Propan-1-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
