CAS 884504-40-9

1-(2,3-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone

Description:

1-(2,3-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone, with the CAS number 884504-40-9, is an organic compound characterized by its complex molecular structure, which includes a propanone moiety linked to a dimethoxyphenyl group and a dioxane ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of methoxy groups enhances its electron-donating ability, which can influence its chemical behavior and interactions. The dioxane ring adds to the compound's stability and may also affect its polarity. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activities and applications in synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications. Overall, this compound represents a unique structure that may have implications in various chemical and pharmaceutical contexts.

Formula: C₁₅H₂₀O₅

InChI: InChI=1S/C15H20O5/c1-17-13-6-3-5-11(15(13)18-2)12(16)7-8-14-19-9-4-10-20-14/h3,5-6,14H,4,7-10H2,1-2H3

InChI key: InChIKey=VBUXXXQQBQHCSW-UHFFFAOYSA-N

SMILES: C(CCC1OCCCO1)(=O)C2=C(OC)C(OC)=CC=C2

Synonyms:

• 1-(2,3-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone
• 1-Propanone, 1-(2,3-Dimethoxyphenyl)-3-(1,3-Dioxan-2-Yl)-