CAS 884504-41-0
:1-(2,4-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone
Description:
1-(2,4-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone, with the CAS number 884504-41-0, is an organic compound characterized by its complex structure that includes a propanone moiety and a dioxane ring. This compound features a phenyl group substituted with two methoxy groups at the 2 and 4 positions, which can influence its electronic properties and reactivity. The presence of the dioxane ring contributes to its stability and solubility in various solvents. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in medicinal chemistry. The methoxy groups can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Additionally, the structural features suggest that it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, depending on the reaction conditions. Overall, this compound's unique structural characteristics may lead to diverse applications in research and industry, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C15H20O5
InChI:InChI=1/C15H20O5/c1-17-11-4-5-12(14(10-11)18-2)13(16)6-7-15-19-8-3-9-20-15/h4-5,10,15H,3,6-9H2,1-2H3
InChI key:InChIKey=CKVMWWUCDJWYPX-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=C(OC)C=C(OC)C=C2
Synonyms:- 1-(2,4-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone
- 1-Propanone, 1-(2,4-Dimethoxyphenyl)-3-(1,3-Dioxan-2-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.