CymitQuimica logo

CAS 884504-44-3

:

1-(3,5-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone

Description:
1-(3,5-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone, with the CAS number 884504-44-3, is an organic compound characterized by its complex structure that includes a propanone moiety and a dioxane ring. The presence of the 3,5-dimethoxyphenyl group contributes to its aromatic properties, which can influence its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic dioxane components. It may participate in various chemical reactions typical of ketones, such as nucleophilic additions and reductions. Additionally, the methoxy groups can enhance its electron-donating capacity, potentially affecting its interaction with biological systems. The dioxane ring may also impart stability and influence the compound's physical properties, such as boiling and melting points. Overall, this compound's unique structural features suggest potential applications in organic synthesis and medicinal chemistry, although specific biological activities and safety profiles would require further investigation.
Formula:C15H20O5
InChI:InChI=1S/C15H20O5/c1-17-12-8-11(9-13(10-12)18-2)14(16)4-5-15-19-6-3-7-20-15/h8-10,15H,3-7H2,1-2H3
InChI key:InChIKey=FZYFNITYJPUKDX-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=CC(OC)=CC(OC)=C2
Synonyms:
  • 1-(3,5-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone
  • 1-Propanone, 1-(3,5-Dimethoxyphenyl)-3-(1,3-Dioxan-2-Yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.