CAS 884504-45-4
:1-(2,3-dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one
Description:
1-(2,3-Dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one, identified by its CAS number 884504-45-4, is an organic compound characterized by its complex structure, which includes a dichlorophenyl group and a dioxane moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the dioxane ring suggests that it may have interesting interactions with polar solvents, while the dichlorophenyl group can influence its electronic properties and biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. Overall, this compound represents a class of molecules that may possess significant chemical versatility and potential utility in various fields of research.
Formula:C13H14Cl2O3
InChI:InChI=1/C13H14Cl2O3/c14-10-4-1-3-9(13(10)15)11(16)5-6-12-17-7-2-8-18-12/h1,3-4,12H,2,5-8H2
SMILES:c1cc(C(=O)CCC2OCCCO2)c(c(c1)Cl)Cl
Synonyms:- 1-Propanone, 1-(2,3-Dichlorophenyl)-3-(1,3-Dioxan-2-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.