CAS 884504-46-5
:1-(2,4-dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one
Description:
1-(2,4-Dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one, with the CAS number 884504-46-5, is a synthetic organic compound characterized by its unique structure that includes a dichlorophenyl group and a dioxane moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the dioxane ring suggests that it may have interesting interactions with biological systems, potentially influencing its pharmacological properties. The dichlorophenyl substituent may enhance its lipophilicity, affecting its distribution in biological systems. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. As with many synthetic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, this compound's structural features suggest potential applications in medicinal chemistry and materials science, warranting further investigation into its properties and uses.
Formula:C13H14Cl2O3
InChI:InChI=1/C13H14Cl2O3/c14-9-2-3-10(11(15)8-9)12(16)4-5-13-17-6-1-7-18-13/h2-3,8,13H,1,4-7H2
SMILES:C1COC(CCC(=O)c2ccc(cc2Cl)Cl)OC1
Synonyms:- 1-Propanone, 1-(2,4-Dichlorophenyl)-3-(1,3-Dioxan-2-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.