CAS 884504-48-7
:1-(3,4-dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one
Description:
1-(3,4-Dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one, with the CAS number 884504-48-7, is an organic compound characterized by its complex structure that includes a propanone moiety and a dioxane ring. This compound features a dichlorophenyl group, which contributes to its potential biological activity and lipophilicity. The presence of the dioxane ring suggests that it may exhibit unique solubility properties and stability under various conditions. Typically, compounds of this nature may be investigated for their pharmacological properties, including potential applications in medicinal chemistry. The dichlorophenyl substituent can influence the compound's reactivity and interaction with biological targets. Additionally, the overall molecular structure may impart specific physical properties, such as melting and boiling points, which are essential for understanding its behavior in different environments. As with many organic compounds, safety and handling precautions are necessary due to potential toxicity or reactivity, particularly given the presence of halogen atoms.
Formula:C13H14Cl2O3
InChI:InChI=1/C13H14Cl2O3/c14-10-3-2-9(8-11(10)15)12(16)4-5-13-17-6-1-7-18-13/h2-3,8,13H,1,4-7H2
SMILES:C1COC(CCC(=O)c2ccc(c(c2)Cl)Cl)OC1
Synonyms:- 1-Propanone, 1-(3,4-Dichlorophenyl)-3-(1,3-Dioxan-2-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.