CymitQuimica logo

CAS 884504-59-0

:

5-(2-bromophenyl)-5-oxo-pentanenitrile

Description:
5-(2-Bromophenyl)-5-oxo-pentanenitrile, identified by its CAS number 884504-59-0, is an organic compound characterized by its unique structure that includes a bromophenyl group and a nitrile functional group. This compound features a pentanenitrile backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The oxo group (carbonyl) adds to its reactivity, allowing for further functionalization. Typically, compounds like this may exhibit moderate to high polarity due to the nitrile and carbonyl groups, influencing their solubility in polar solvents. Additionally, the compound may have specific applications in pharmaceuticals or agrochemicals, given the presence of the bromophenyl moiety, which is often associated with bioactive properties. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H10BrNO
InChI:InChI=1/C11H10BrNO/c12-10-6-2-1-5-9(10)11(14)7-3-4-8-13/h1-2,5-6H,3-4,7H2
SMILES:c1ccc(c(c1)C(=O)CCCC#N)Br
Synonyms:
  • 5-(2-Bromophenyl)-5-Oxopentanenitrile
  • Benzenepentanenitrile, 2-Bromo-Δ-Oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.