CymitQuimica logo

CAS 884504-60-3

:

3-Bromo-δ-oxobenzenepentanenitrile

Description:
3-Bromo-δ-oxobenzenepentanenitrile, identified by its CAS number 884504-60-3, is a chemical compound that features a bromine atom, a nitrile group, and a ketone functional group within its structure. This compound is characterized by its aromatic ring, which contributes to its stability and reactivity. The presence of the bromine substituent typically enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The nitrile group (-C≡N) is known for its ability to participate in a range of organic transformations, such as hydrolysis and reduction, while the ketone functionality can engage in reactions like aldol condensations. The overall molecular structure suggests potential applications in organic synthesis, pharmaceuticals, and materials science. Additionally, the compound's physical properties, such as solubility and melting point, would depend on its specific molecular interactions and the presence of functional groups. As with many organic compounds, safety precautions should be observed when handling 3-Bromo-δ-oxobenzenepentanenitrile due to its potential toxicity and reactivity.
Formula:C11H10BrNO
InChI:InChI=1S/C11H10BrNO/c12-10-5-3-4-9(8-10)11(14)6-1-2-7-13/h3-5,8H,1-2,6H2
InChI key:InChIKey=IDFOKMZILFRNAC-UHFFFAOYSA-N
SMILES:C(CCCC#N)(=O)C1=CC(Br)=CC=C1
Synonyms:
  • 3-Bromo-δ-oxobenzenepentanenitrile
  • 5-(3-Bromophenyl)-5-Oxopentanenitrile
  • Benzenepentanenitrile, 3-Bromo-Δ-Oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.