CAS 884504-63-6
:3-Bromo-γ-oxobenzenebutanenitrile
Description:
3-Bromo-γ-oxobenzenebutanenitrile, identified by its CAS number 884504-63-6, is a chemical compound that features a bromine atom, a cyano group, and a ketone functional group within its structure. This compound typically exhibits characteristics common to nitriles, such as being polar and having a relatively high boiling point compared to non-polar compounds of similar molecular weight. The presence of the bromine atom can influence its reactivity, making it susceptible to nucleophilic substitution reactions. The oxo group contributes to its potential as a reactive intermediate in organic synthesis, while the cyano group can participate in various chemical reactions, including hydrolysis and reduction. The compound may also exhibit moderate solubility in polar solvents due to its functional groups. Overall, 3-Bromo-γ-oxobenzenebutanenitrile is of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, where its unique functional groups can be leveraged for further chemical transformations.
Formula:C10H8BrNO
InChI:InChI=1S/C10H8BrNO/c11-9-4-1-3-8(7-9)10(13)5-2-6-12/h1,3-4,7H,2,5H2
InChI key:InChIKey=VBCZDOXEUMMZLF-UHFFFAOYSA-N
SMILES:C(CCC#N)(=O)C1=CC(Br)=CC=C1
Synonyms:- 3-Bromo-γ-oxobenzenebutanenitrile
- Benzenebutanenitrile, 3-Bromo-Γ-Oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
