CAS 884504-72-7
:4,5,6,7-tetrahydro-1,3-benzothiazole-2-carbaldehyde
Description:
4,5,6,7-Tetrahydro-1,3-benzothiazole-2-carbaldehyde is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a benzothiazole moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and an aldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the benzothiazole ring imparts specific electronic properties, making it of interest in medicinal chemistry and material science. Typically, compounds like this may exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. Its solubility and stability can vary based on the solvent and conditions, and it may undergo typical reactions associated with aldehydes, such as oxidation or condensation. The compound's CAS number, 884504-72-7, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, 4,5,6,7-tetrahydro-1,3-benzothiazole-2-carbaldehyde represents a valuable structure for further exploration in various chemical applications.
Formula:C8H9NOS
InChI:InChI=1/C8H9NOS/c10-5-8-9-6-3-1-2-4-7(6)11-8/h5H,1-4H2
SMILES:C1CCc2c(C1)nc(C=O)s2
Synonyms:- 2-Benzothiazolecarboxaldehyde, 4,5,6,7-Tetrahydro-
- 4,5,6,7-Tetrahydro-1,3-benzothiazole-2-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4,5,6,7-tetrahydro-1,3-benzothiazole-2-carbaldehyde
CAS:Controlled ProductFormula:C8H9NOSColor and Shape:NeatMolecular weight:167.23
