CAS 884504-73-8
:N-methyl-1-[1-(1-methylethyl)pyrrolidin-3-yl]methanamine
Description:
N-methyl-1-[1-(1-methylethyl)pyrrolidin-3-yl]methanamine, with the CAS number 884504-73-8, is a chemical compound that belongs to the class of amines. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a methyl group and an isopropyl group, contributing to its structural complexity. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. The presence of the nitrogen atom in the pyrrolidine ring and the amine functional group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the steric hindrance introduced by the isopropyl group may affect its interaction with biological targets. As with many amines, it may exhibit basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Understanding its characteristics is crucial for exploring its potential applications in drug development and other chemical processes.
Formula:C9H20N2
InChI:InChI=1/C9H20N2/c1-8(2)11-5-4-9(7-11)6-10-3/h8-10H,4-7H2,1-3H3
SMILES:CC(C)N1CCC(CNC)C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
